CAS 228728-19-6 appears in our catalog under these names: 6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid, 95%, 6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid, 97%, 6,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
6,8-difluoro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 228728-19-6) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 6,8-difluoro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: SUJKVJSPRDGSJX-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 6,8-difluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | SUJKVJSPRDGSJX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=CN2)C(=O)O)F)F |
Computed by PubChem (NCBI)