cas: 885465-97-4 — see every product listed under this CAS number, including other names
3-Thiazol-2-yl-benzaldehyde 95% (CAS 885465-97-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A275311-5g |
| cas | 885465-97-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 2689.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A275311 |
3-(1,3-thiazol-2-yl)benzaldehyde (CAS 885465-97-4) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 3-(1,3-thiazol-2-yl)benzaldehyde. InChIKey: YJMGIEKCDQXKKZ-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 3-(1,3-thiazol-2-yl)benzaldehyde |
| InChIKey | YJMGIEKCDQXKKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CS2)C=O |
Computed by PubChem (NCBI)