cas: 6652-16-0 — see every product listed under this CAS number, including other names
3-Trifluoromethylphenylpiperidine hydrochloride, 97% (CAS 6652-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038399-250MG |
| cas | 6652-16-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 950.72 Pln | |
| Fluorochem | 10g | 1846.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 6652-16-0) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: OGZONGZRKSIERU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | OGZONGZRKSIERU-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)