CAS 1391417-19-8 appears in our catalog under these names: (R)-2-(2-(Trifluoromethyl)phenyl)piperidine hydrochloride, 95%, (R)–2–(2–(Trifluoromethyl)phenyl)piperidine hydrochloride, (R)-2-(2-(Trifluoromethyl)phenyl)piperidine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 1391417-19-8) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: (2R)-2-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: NBVVWIDMOJBRLN-RFVHGSKJSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | (2R)-2-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | NBVVWIDMOJBRLN-RFVHGSKJSA-N |
| SMILES | C1CCN[C@H](C1)C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)