CAS 6652-16-0 appears in our catalog under these names: 4-(3-Trifluoromethylphenyl)piperidine hydrochloride, 98%, 4–(3–(Trifluoromethyl)phenyl)piperidine hydrochloride, 4-(3-(Trifluoromethyl)phenyl)piperidine hydrochloride, 97%, 97%, 3-Trifluoromethylphenylpiperidine hydrochloride, 97%, 4-(3-(Trifluoromethyl)phenyl)piperidine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
4-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 6652-16-0) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: OGZONGZRKSIERU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | OGZONGZRKSIERU-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)