Products 1106940-96-8
CAS 1106940-96-8 is the registry number for 3-(4-(Trifluoromethyl)phenyl)piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[4-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 1106940-96-8) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: GNERKUYVCOPIJA-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | GNERKUYVCOPIJA-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)