cas: 459434-39-0 — see every product listed under this CAS number, including other names
3-amino-N-cyclopropylbenzenesulfonamide, 96% (CAS 459434-39-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F368075-1G |
| cas | 459434-39-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1346.42 Pln | |
| Fluorochem | 25g | 6250.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-N-cyclopropylbenzenesulfonamide (CAS 459434-39-0) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 3-amino-N-cyclopropylbenzenesulfonamide. InChIKey: MEFGSBDEWJXTLO-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 3-amino-N-cyclopropylbenzenesulfonamide |
| InChIKey | MEFGSBDEWJXTLO-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)