cas: 25981-82-2 — see every product listed under this CAS number, including other names
3H-Indole, 2,3,3,5-tetramethyl-, 97%, 97% (CAS 25981-82-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113RAW-1g |
| cas | 25981-82-2 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 100g | 765.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3,3,5-tetramethylindole (CAS 25981-82-2) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 2,3,3,5-tetramethylindole. InChIKey: RQVAPBRSUHSDGP-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 2,3,3,5-tetramethylindole |
| InChIKey | RQVAPBRSUHSDGP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C2(C)C)C |
Computed by PubChem (NCBI)