cas: 5426-09-5 — see every product listed under this CAS number, including other names
3a,4,7,7a-Tetrahydro-4,7-epoxyisobenzofuran-1,3-dione, 95% (CAS 5426-09-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689942-5G |
| cas | 5426-09-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 997.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 5426-09-5) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: QQYNRBAAQFZCLF-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | QQYNRBAAQFZCLF-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C(C1O2)C(=O)OC3=O |
Computed by PubChem (NCBI)