CAS 5426-09-5 appears in our catalog under these names: 4,10-dioxatricyclo[5.2.1.0^{2,6}]dec-8-ene-3,5-dione, 95%, 4,10-Dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione, 97%, 97%, 4,10-Dioxatri cyclo[5.2. 1.02.6]dec-8-ene-3,5-dione, 97.0%. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100g, 1 g, 10mM/1mL.
4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 5426-09-5) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: QQYNRBAAQFZCLF-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | QQYNRBAAQFZCLF-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C(C1O2)C(=O)OC3=O |
Computed by PubChem (NCBI)