CAS 3260-49-9 appears in our catalog under these names: 4,6-Dihydroxybenzofuran-3(2h)-one, 95%, 4,6–Dihydroxybenzofuran–3(2H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4,6-dihydroxy-1-benzofuran-3-one (CAS 3260-49-9) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 4,6-dihydroxy-1-benzofuran-3-one. InChIKey: OPSLRXQDYBYKHC-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4,6-dihydroxy-1-benzofuran-3-one |
| InChIKey | OPSLRXQDYBYKHC-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C=C(C=C2O1)O)O |
Computed by PubChem (NCBI)