cas: 5426-09-5 — see every product listed under this CAS number, including other names
4,10-Dioxatri cyclo[5.2. 1.02.6]dec-8-ene-3,5-dione, 97.0% (CAS 5426-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10mM/1mL, 5 g, 50 g, 25 g, 100 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W102981-1 g |
| cas | 5426-09-5 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 5 g | 454.37 Pln | |
| MedChemExpress | 50 g | 2205.16 Pln | |
| MedChemExpress | 25 g | 1415.68 Pln | |
| MedChemExpress | 100 g | 3454.39 Pln | |
| MedChemExpress | 10 g | 695.86 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 5426-09-5) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: QQYNRBAAQFZCLF-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | QQYNRBAAQFZCLF-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C(C1O2)C(=O)OC3=O |
Computed by PubChem (NCBI)