cas: 5730-76-7 — see every product listed under this CAS number, including other names
4'-Amino-biphenyl-4-carboxylic acid methyl ester, 98% (CAS 5730-76-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032153-1G |
| cas | 5730-76-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 10g | 2215.90 Pln | |
| Fluorochem | 25g | 4376.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-(4-aminophenyl)benzoate (CAS 5730-76-7) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: methyl 4-(4-aminophenyl)benzoate. InChIKey: KKPVZEJEFMQVSQ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | methyl 4-(4-aminophenyl)benzoate |
| InChIKey | KKPVZEJEFMQVSQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)