CAS 16524-23-5 appears in our catalog under these names: 2-[(4-Methylphenyl)amino]benzoic acid, 95%, 2-(p-Tolylamino)benzoic acid, 95+%, 2–((4–Methylphenyl)amino)benzoic Acid, 2-((4-Methylphenyl)amino)benzoic acid, 2-(p-Tolylamino)benzoic acid, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 10mg, 0,5g.
2-(4-methylanilino)benzoic acid (CAS 16524-23-5) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 2-(4-methylanilino)benzoic acid. InChIKey: DEFSEYPSVLNHBM-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2-(4-methylanilino)benzoic acid |
| InChIKey | DEFSEYPSVLNHBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)