CAS 61822-18-2 appears in our catalog under these names: 2,7-Dimethoxy-9h-carbazole, 95%, 2,7–Dimethoxy–9H–carbazole, 2,7-Dimethoxy-9H-carbazole, 2,7-Dimethoxy-9H-carbazole, >98.0%(GC), 9H-Carbazole, 2,7-dimethoxy-, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 1000mg, 2000mg, 25g.
2,7-dimethoxy-9H-carbazole (CAS 61822-18-2) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 2,7-dimethoxy-9H-carbazole. InChIKey: OFGBQGFYHXYVIA-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2,7-dimethoxy-9H-carbazole |
| InChIKey | OFGBQGFYHXYVIA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(N2)C=C(C=C3)OC |
Computed by PubChem (NCBI)