Products 35708-19-1
CAS 35708-19-1 appears in our catalog under these names: 2-Anilinobenzoic acid methyl ester, 95%, 2-Anilinobenzoic acid methyl ester, 98%, 98%, 2-Anilinobenzoic acid methyl ester, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
Methyl 2-anilinobenzoate (CAS 35708-19-1) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: methyl 2-anilinobenzoate. InChIKey: ODDHBYXHXZCAGQ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | methyl 2-anilinobenzoate |
| InChIKey | ODDHBYXHXZCAGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1NC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-Anilinobenzoic acid methyl ester, Methyl 2-anilinobenzoate, methyl 2-(phenylamino)benzoate, Methyl N-phenylanthranilate, Benzoic acid, 2-(phenylamino)-, methyl ester, o-Diphenylaminecarboxylic acid methyl ester, Methyl 2-anilinobenzoate #, methyl 2-phenylaminobenzoate, Oprea1_135725, 2-Anilinobenzoicacidmethylester