CAS 202831-65-0 appears in our catalog under these names: 4-Bromo-4'-(diphenylamino)biphenyl, 97%, 4–Bromo–4'–(diphenylamino)biphenyl, 4-Bromo-4'-(diphenylamino)biphenyl, >93.0%(GC), 4'-Bromo-N,N-diphenyl-[1,1'-biphenyl]-4-amine, 97%, 97%, 4'-Bromo-N,N-diphenyl-[1,1'-biphenyl]-4-amine, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100g.
4-(4-bromophenyl)-N,N-diphenylaniline (CAS 202831-65-0) is a chemical compound with the molecular formula C24H18BrN and a molecular weight of 400.3 g/mol. IUPAC name: 4-(4-bromophenyl)-N,N-diphenylaniline. InChIKey: NKCKVJVKWGWKRK-UHFFFAOYSA-N.
| Molecular formula | C24H18BrN |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 4-(4-bromophenyl)-N,N-diphenylaniline |
| InChIKey | NKCKVJVKWGWKRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)