cas: 20139-55-3 — see every product listed under this CAS number, including other names
4'-Chloro-2'-methylacetoacetanilide, >98.0%(HPLC)(N) (CAS 20139-55-3) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2104-25G |
| cas | 20139-55-3 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 187.19 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
N-(4-chloro-2-methylphenyl)-3-oxobutanamide (CAS 20139-55-3) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: N-(4-chloro-2-methylphenyl)-3-oxobutanamide. InChIKey: ODFRAIZRJMUPCP-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | N-(4-chloro-2-methylphenyl)-3-oxobutanamide |
| InChIKey | ODFRAIZRJMUPCP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)NC(=O)CC(=O)C |
Computed by PubChem (NCBI)