CAS 1236862-45-5 appears in our catalog under these names: 3',4'-Dihydrospiro[azetidine-3,2'-[1]benzopyran]-4'-one hydrochloride, 95%, Spiro(azetidine-3,2'-(2H-1)benzopyran)-4'(3'H)-one, hydrochloride, 98%, Spiro(azetidine–3,2'–(2H–1)benzopyran)–4'(3'H)–one, hydrochloride, 3',4'-Dihydrospiro(azetidine-3,2'-(1)benzopyran)-4'-one hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 0,5g, 50mg.
Spiro[3H-chromene-2,3'-azetidine]-4-one;hydrochloride (CAS 1236862-45-5) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: spiro[3H-chromene-2,3'-azetidine]-4-one;hydrochloride. InChIKey: TYWUOQGJIFWZDU-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | spiro[3H-chromene-2,3'-azetidine]-4-one;hydrochloride |
| InChIKey | TYWUOQGJIFWZDU-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC=CC=C2OC13CNC3.Cl |
Computed by PubChem (NCBI)