Products 1260593-59-6
CAS 1260593-59-6 appears in our catalog under these names: Trans-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid, 95%, trans–4–(2–Chlorophenyl)pyrrolidine–3–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(3R,4S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid (CAS 1260593-59-6) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: (3R,4S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: JGQMSOHBYCXLNS-BDAKNGLRSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | (3R,4S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | JGQMSOHBYCXLNS-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)