CAS 1047651-80-8 appears in our catalog under these names: (3R,4S)-4-(3-Chlorophenyl)pyrrolidine-3-carboxylic acid, 95%, (3R,4S)–4–(3–Chlorophenyl)pyrrolidine–3–carboxylic acid, (3R,4S)-4-(3-Chlorophenyl)pyrrolidine-3-carboxylic acid, 97%, 97%, (3R,4S)-4-(3-Chlorophenyl)pyrrolidine-3-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(3S,4R)-4-(3-chlorophenyl)pyrrolidine-3-carboxylic acid (CAS 1047651-80-8) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: (3S,4R)-4-(3-chlorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: BJGWYFRCQPUPCO-VHSXEESVSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | (3S,4R)-4-(3-chlorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | BJGWYFRCQPUPCO-VHSXEESVSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)