cas: 192863-46-0 — see every product listed under this CAS number, including other names
4'-Fluoro-[1,1'-biphenyl]-2-carbaldehyde 98% (CAS 192863-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A325971-100mg |
| cas | 192863-46-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1416.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A325971 |
2-(4-fluorophenyl)benzaldehyde (CAS 192863-46-0) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 2-(4-fluorophenyl)benzaldehyde. InChIKey: QENDTDXVOJYDLG-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-(4-fluorophenyl)benzaldehyde |
| InChIKey | QENDTDXVOJYDLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)