cas: 38861-78-8 — see every product listed under this CAS number, including other names
4'-Isobutylacetophenone 97% (CAS 38861-78-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217619-5g |
| cas | 38861-78-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 782.00 Pln | |
| Ambeed | 500g | 2567.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217619 |
1-[4-(2-methylpropyl)phenyl]ethanone (CAS 38861-78-8) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-[4-(2-methylpropyl)phenyl]ethanone. InChIKey: KEAGRYYGYWZVPC-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-[4-(2-methylpropyl)phenyl]ethanone |
| InChIKey | KEAGRYYGYWZVPC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)