cas: 720-73-0 — see every product listed under this CAS number, including other names
4'-Methyl-4-biphenylcarboxylic acid, 97%, 97% (CAS 720-73-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119QYB-100mg |
| cas | 720-73-0 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 386.00 Pln | |
| Chemat | 25g | 837.20 Pln | |
| Chemat | 100g | 2584.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4-methylphenyl)benzoic acid (CAS 720-73-0) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-(4-methylphenyl)benzoic acid. InChIKey: RZOCCLOTCXINRG-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-(4-methylphenyl)benzoic acid |
| InChIKey | RZOCCLOTCXINRG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)