cas: 720-73-0 — see every product listed under this CAS number, including other names
4'-Methylbiphenyl-4-carboxylic acid, 97% (CAS 720-73-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010810-1G |
| cas | 720-73-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 10g | 450.90 Pln | |
| Fluorochem | 25g | 1034.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-methylphenyl)benzoic acid (CAS 720-73-0) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-(4-methylphenyl)benzoic acid. InChIKey: RZOCCLOTCXINRG-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-(4-methylphenyl)benzoic acid |
| InChIKey | RZOCCLOTCXINRG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)