cas: 64835-63-8 — see every product listed under this CAS number, including other names
4'-Methyl-4-pentylbiphenyl, >98.0%(GC) (CAS 64835-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2885-1G |
| cas | 64835-63-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 241.28 Pln | |
| TCI | 5g | 723.17 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-methyl-4-(4-pentylphenyl)benzene (CAS 64835-63-8) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1-methyl-4-(4-pentylphenyl)benzene. InChIKey: ZGBOHJUSTPZQPL-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1-methyl-4-(4-pentylphenyl)benzene |
| InChIKey | ZGBOHJUSTPZQPL-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)