cas: 64835-63-8 — see every product listed under this CAS number, including other names
4-Methyl-4'-pentyl-1,1'-biphenyl 98% (CAS 64835-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111438-1g |
| cas | 64835-63-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 25g | 1304.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111438 |
1-methyl-4-(4-pentylphenyl)benzene (CAS 64835-63-8) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1-methyl-4-(4-pentylphenyl)benzene. InChIKey: ZGBOHJUSTPZQPL-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1-methyl-4-(4-pentylphenyl)benzene |
| InChIKey | ZGBOHJUSTPZQPL-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)