4-Methyl-4'-pentyl-1,1'-biphenyl, 98%
cas: 64835-63-8 — see every product listed under this CAS number, including other names
4-Methyl-4'-pentyl-1,1'-biphenyl, 98% (CAS 64835-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A111438-1g |
| cas | 64835-63-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1176.94 Pln | |
| BLDpharm | 1g | 231.05 Pln | |
| BLDpharm | 5g | 386.56 Pln | |
| BLDpharm | 25g | 1152.95 Pln | |
| BLDpharm | 100g | 4385.15 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 25g | 1205.84 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-methyl-4-(4-pentylphenyl)benzene (CAS 64835-63-8) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1-methyl-4-(4-pentylphenyl)benzene. InChIKey: ZGBOHJUSTPZQPL-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1-methyl-4-(4-pentylphenyl)benzene |
| InChIKey | ZGBOHJUSTPZQPL-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)