cas: 52364-73-5 — see every product listed under this CAS number, including other names
4'-Octyloxy-[1,1'-biphenyl]-4-carbonitrile 98% (CAS 52364-73-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A253760-250mg |
| cas | 52364-73-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 392.62 Pln | |
| Ambeed | 100g | 1366.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A253760 |
4-(4-octoxyphenyl)benzonitrile (CAS 52364-73-5) is a chemical compound with the molecular formula C21H25NO and a molecular weight of 307.4 g/mol. IUPAC name: 4-(4-octoxyphenyl)benzonitrile. InChIKey: GPGGNNIMKOVSAG-UHFFFAOYSA-N.
| Molecular formula | C21H25NO |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4-(4-octoxyphenyl)benzonitrile |
| InChIKey | GPGGNNIMKOVSAG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)