CAS 2734288-05-0 is the registry number for Terbinafine Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine oxide (CAS 2734288-05-0) is a chemical compound with the molecular formula C21H25NO and a molecular weight of 307.4 g/mol. IUPAC name: (E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine oxide. InChIKey: JKWYHCFRDQLODW-WEVVVXLNSA-N.
| Molecular formula | C21H25NO |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine oxide |
| InChIKey | JKWYHCFRDQLODW-WEVVVXLNSA-N |
| SMILES | CC(C)(C)C#C/C=C/C[N+](C)(CC1=CC=CC2=CC=CC=C21)[O-] |
Computed by PubChem (NCBI)