CAS 1024113-59-4 is the registry number for 1-phenyl-N-(2,4,6-trimethylphenyl)cyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-phenyl-N-(2,4,6-trimethylphenyl)cyclopentane-1-carboxamide (CAS 1024113-59-4) is a chemical compound with the molecular formula C21H25NO and a molecular weight of 307.4 g/mol. IUPAC name: 1-phenyl-N-(2,4,6-trimethylphenyl)cyclopentane-1-carboxamide. InChIKey: ZVFBNTIQSBWWQA-UHFFFAOYSA-N.
| Molecular formula | C21H25NO |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 1-phenyl-N-(2,4,6-trimethylphenyl)cyclopentane-1-carboxamide |
| InChIKey | ZVFBNTIQSBWWQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)C2(CCCC2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)