CAS 142138-83-8 is the registry number for (2S,3aS,7aS)–Octahydro–α,α–diphenyl–1H–indole–2–methanol. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-diphenylmethanol (CAS 142138-83-8) is a chemical compound with the molecular formula C21H25NO and a molecular weight of 307.4 g/mol. IUPAC name: [(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-diphenylmethanol. InChIKey: MTNGHTJKJJXWCJ-VDGAXYAQSA-N.
| Molecular formula | C21H25NO |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | [(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-diphenylmethanol |
| InChIKey | MTNGHTJKJJXWCJ-VDGAXYAQSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C[C@H](N2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)