cas: 343604-24-0 — see every product listed under this CAS number, including other names
4'-Trifluoromethylbiphenyl-3-carbaldehyde, 95% (CAS 343604-24-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014317-250MG |
| cas | 343604-24-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 591.48 Pln | |
| Fluorochem | 25g | 1127.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[4-(trifluoromethyl)phenyl]benzaldehyde (CAS 343604-24-0) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: JLQBHCYLEQJWCE-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | JLQBHCYLEQJWCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)C(F)(F)F)C=O |
Computed by PubChem (NCBI)