cas: 90035-34-0 — see every product listed under this CAS number, including other names
4'-Trifluoromethylbiphenyl-4-carbaldehyde, 97% (CAS 90035-34-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014318-5G |
| cas | 90035-34-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 331.15 Pln | |
| Fluorochem | 25g | 752.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[4-(trifluoromethyl)phenyl]benzaldehyde (CAS 90035-34-0) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: HIMSXOOFWOOYFK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | HIMSXOOFWOOYFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)