CAS 1224713-90-9 appears in our catalog under these names: 5-[(E)-2-(4-Bromophenyl)vinyl]benzene-1,3-diol, 97%, 4'-Bromo-resveratrol, 98%, 4'-bromo-Resveratrol/ 99.4% (existing batch purity), 4'–bromo–Resveratrol, 5-((E)-2-(4-Bromophenyl)vinyl)benzene-1,3-diol. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 5g, 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
5-[(E)-2-(4-bromophenyl)ethenyl]benzene-1,3-diol (CAS 1224713-90-9) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 5-[(E)-2-(4-bromophenyl)ethenyl]benzene-1,3-diol. InChIKey: NCJVLKFAQIWASE-OWOJBTEDSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 5-[(E)-2-(4-bromophenyl)ethenyl]benzene-1,3-diol |
| InChIKey | NCJVLKFAQIWASE-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)Br |
Computed by PubChem (NCBI)