cas: 933047-52-0 — see every product listed under this CAS number, including other names
4,4'',4'''',4''''''-(1,3,6,8-Pyrenetetrayl)tetrakis[benzoic acid], 98%, 98% (CAS 933047-52-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKL5-100mg |
| cas | 933047-52-0 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 458.00 Pln | |
| Chemat | 25g | 1850.00 Pln | |
| Chemat | 100g | 7197.20 Pln | |
| Chemat | 250g | 11128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid (CAS 933047-52-0) is a chemical compound with the molecular formula C44H26O8 and a molecular weight of 682.7 g/mol. IUPAC name: 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid. InChIKey: HVCDAMXLLUJLQZ-UHFFFAOYSA-N.
| Molecular formula | C44H26O8 |
|---|---|
| Molecular weight | 682.7 g/mol |
| IUPAC name | 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid |
| InChIKey | HVCDAMXLLUJLQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=C(C=C6)C(=O)O)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)