CAS 933047-52-0 appears in our catalog under these names: 1,3,6,8–Tetrakis(p–benzoic acid)pyrene, 1,3,6,8-Tetra(4'-carboxyphenyl)pyrene, 4,4'',4'''',4''''''-(1,3,6,8-Pyrenetetrayl)tetrakis[benzoic acid], 98%, 98%, 4,4',4'',4'''-(PYRENE-1,3,6,8-TETRAYL)TETRABENZOIC ACID, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 0,5g, 0,25g, 100mg, 250mg, 25g.
4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid (CAS 933047-52-0) is a chemical compound with the molecular formula C44H26O8 and a molecular weight of 682.7 g/mol. IUPAC name: 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid. InChIKey: HVCDAMXLLUJLQZ-UHFFFAOYSA-N.
| Molecular formula | C44H26O8 |
|---|---|
| Molecular weight | 682.7 g/mol |
| IUPAC name | 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid |
| InChIKey | HVCDAMXLLUJLQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=C(C=C6)C(=O)O)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)