Products 2629901-73-9
CAS 2629901-73-9 is the registry number for 4,4',4'',4'''-(Pyrene-4,5,9,10-tetrayl)tetrabenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[5,9,10-tris(4-carboxyphenyl)pyren-4-yl]benzoic acid (CAS 2629901-73-9) is a chemical compound with the molecular formula C44H26O8 and a molecular weight of 682.7 g/mol. IUPAC name: 4-[5,9,10-tris(4-carboxyphenyl)pyren-4-yl]benzoic acid. InChIKey: BAHOMTGANRRTON-UHFFFAOYSA-N.
| Molecular formula | C44H26O8 |
|---|---|
| Molecular weight | 682.7 g/mol |
| IUPAC name | 4-[5,9,10-tris(4-carboxyphenyl)pyren-4-yl]benzoic acid |
| InChIKey | BAHOMTGANRRTON-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=C(C4=CC=CC(=C43)C(=C2C5=CC=C(C=C5)C(=O)O)C6=CC=C(C=C6)C(=O)O)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O |
Computed by PubChem (NCBI)