CAS 1598415-56-5 appears in our catalog under these names: 3,3′,3′′,3′′′-(1,3,6,8-Pyrenetetrayl)tetrakis[benzoic acid], 95%, 95%, 1,3,6,8-Tetrakis(3-carboxyphenyl)pyrene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[3,6,8-tris(3-carboxyphenyl)pyren-1-yl]benzoic acid (CAS 1598415-56-5) is a chemical compound with the molecular formula C44H26O8 and a molecular weight of 682.7 g/mol. IUPAC name: 3-[3,6,8-tris(3-carboxyphenyl)pyren-1-yl]benzoic acid. InChIKey: UTDAVNYASDGESU-UHFFFAOYSA-N.
| Molecular formula | C44H26O8 |
|---|---|
| Molecular weight | 682.7 g/mol |
| IUPAC name | 3-[3,6,8-tris(3-carboxyphenyl)pyren-1-yl]benzoic acid |
| InChIKey | UTDAVNYASDGESU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC(=CC=C6)C(=O)O)C7=CC(=CC=C7)C(=O)O)C8=CC(=CC=C8)C(=O)O |
Computed by PubChem (NCBI)