cas: 14544-47-9 — see every product listed under this CAS number, including other names
4,4',4''-(1,3,5-Triazine-2,4,6-triyl)trianiline, 95% (CAS 14544-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F226109-100MG |
| cas | 14544-47-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 492.55 Pln | |
| Fluorochem | 10g | 919.49 Pln | |
| Fluorochem | 25g | 1388.07 Pln | |
| Fluorochem | 100g | 5006.59 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 937.75 Pln | |
| Ambeed | 25g | 1338.25 Pln | |
| Ambeed | 100g | 4892.69 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-[4,6-bis(4-aminophenyl)-1,3,5-triazin-2-yl]aniline (CAS 14544-47-9) is a chemical compound with the molecular formula C21H18N6 and a molecular weight of 354.4 g/mol. IUPAC name: 4-[4,6-bis(4-aminophenyl)-1,3,5-triazin-2-yl]aniline. InChIKey: WHSQATVVMVBGNS-UHFFFAOYSA-N.
| Molecular formula | C21H18N6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-[4,6-bis(4-aminophenyl)-1,3,5-triazin-2-yl]aniline |
| InChIKey | WHSQATVVMVBGNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)