Products 869767-86-2
CAS 869767-86-2 is the registry number for DB1055. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(3-carbamimidoylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide (CAS 869767-86-2) is a chemical compound with the molecular formula C21H18N6 and a molecular weight of 354.4 g/mol. IUPAC name: 2-[4-(3-carbamimidoylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide. InChIKey: JTEAXLWMBHFLPI-UHFFFAOYSA-N.
| Molecular formula | C21H18N6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 2-[4-(3-carbamimidoylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide |
| InChIKey | JTEAXLWMBHFLPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=N)N)C2=CC=C(C=C2)C3=NC4=C(N3)C=C(C=C4)C(=N)N |
Computed by PubChem (NCBI)