CAS 1973-05-3 appears in our catalog under these names: N2,N4,N6–Triphenyl–1,3,5–triazine–2,4,6–triamine, N2,N4,N6-Triphenyl-1,3,5-triazine-2,4,6-triamine, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine (CAS 1973-05-3) is a chemical compound with the molecular formula C21H18N6 and a molecular weight of 354.4 g/mol. IUPAC name: 2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine. InChIKey: GGHBKCSNURXPNB-UHFFFAOYSA-N.
| Molecular formula | C21H18N6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 2-N,4-N,6-N-triphenyl-1,3,5-triazine-2,4,6-triamine |
| InChIKey | GGHBKCSNURXPNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)NC3=CC=CC=C3)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)