CAS 247171-74-0 appears in our catalog under these names: 3,3',3''-(1,3,5-Triazine-2,4,6-triyl)trianiline, 95%+, 95%+, 3,3',3"-(1,3,5-Triazine-2,4,6-triyl)trianiline, 98%, 3,3',3''-(1,3,5-Triazine-2,4,6-triyl)trianiline, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-[4,6-bis(3-aminophenyl)-1,3,5-triazin-2-yl]aniline (CAS 247171-74-0) is a chemical compound with the molecular formula C21H18N6 and a molecular weight of 354.4 g/mol. IUPAC name: 3-[4,6-bis(3-aminophenyl)-1,3,5-triazin-2-yl]aniline. InChIKey: MOMJMPQUSXVNEC-UHFFFAOYSA-N.
| Molecular formula | C21H18N6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 3-[4,6-bis(3-aminophenyl)-1,3,5-triazin-2-yl]aniline |
| InChIKey | MOMJMPQUSXVNEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC(=NC(=N2)C3=CC(=CC=C3)N)C4=CC(=CC=C4)N |
Computed by PubChem (NCBI)