cas: 2425-95-8 — see every product listed under this CAS number, including other names
4,4'-(1,3,4-Oxadiazole-2,5-diyl)dianiline, 98%, 98% (CAS 2425-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FVX-100mg |
| cas | 2425-95-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 947.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline (CAS 2425-95-8) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: MJZXFMSIHMJQBW-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | MJZXFMSIHMJQBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)