cas: 2425-95-8 — see every product listed under this CAS number, including other names
2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole, >98.0%(HPLC) (CAS 2425-95-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2169-1G |
| cas | 2425-95-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 265.86 Pln | |
| TCI | 5g | 964.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline (CAS 2425-95-8) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: MJZXFMSIHMJQBW-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | MJZXFMSIHMJQBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)