cas: 2425-95-8 — see every product listed under this CAS number, including other names
2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole (CAS 2425-95-8) is a chemical reagent available from Chemat. Available pack sizes: 20mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM25170W-20mg |
| cas | 2425-95-8 |
| size | 20mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 20mg | 949.56 Pln | |
| Chemat | 250mg | 5645.18 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline (CAS 2425-95-8) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: MJZXFMSIHMJQBW-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | MJZXFMSIHMJQBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)