CAS 915916-58-4 is the registry number for 4-Methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline (CAS 915916-58-4) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: WJWIYDXADATTEL-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | WJWIYDXADATTEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C2=NN=C(O2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)