4,4'-Bis(4-(oxiran-2-yl)butoxy)-1,1'-biphenyl, 96%
cas: 134196-39-7 — see every product listed under this CAS number, including other names
4,4'-Bis(4-(oxiran-2-yl)butoxy)-1,1'-biphenyl, 96% (CAS 134196-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1F2C5U-100mg |
| cas | 134196-39-7 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Chemat | 5g | 2061.20 Pln | |
| Fluorochem | 100mg | 336.36 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 950.72 Pln | |
| Fluorochem | 5g | 2705.32 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[4-[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]butyl]oxirane (CAS 134196-39-7) is a chemical compound with the molecular formula C24H30O4 and a molecular weight of 382.5 g/mol. IUPAC name: 2-[4-[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]butyl]oxirane. InChIKey: ZFVWSWLESVITLR-UHFFFAOYSA-N.
| Molecular formula | C24H30O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-[4-[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]butyl]oxirane |
| InChIKey | ZFVWSWLESVITLR-UHFFFAOYSA-N |
| SMILES | C1C(O1)CCCCOC2=CC=C(C=C2)C3=CC=C(C=C3)OCCCCC4CO4 |
Computed by PubChem (NCBI)