cas: 13080-85-8 — see every product listed under this CAS number, including other names
4,4'-Bis(4-aminophenoxy)biphenyl, 99.92% (CAS 13080-85-8) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008680-25 g |
| cas | 13080-85-8 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 263.96 Pln | |
| MedChemExpress | 100 g | 477.59 Pln | |
| MedChemExpress | 50 g | 347.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.92% |
4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline (CAS 13080-85-8) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline. InChIKey: HYDATEKARGDBKU-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline |
| InChIKey | HYDATEKARGDBKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)