cas: 13080-85-8 — see every product listed under this CAS number, including other names
4,4′-Bis(4-aminophenoxy)biphenyl 98% (CAS 13080-85-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A432321-5g |
| cas | 13080-85-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 392.62 Pln | |
| Ambeed | 500g | 1505.12 Pln | |
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 10mg | 197.94 Pln | |
| Ambeed | 25mg | 220.19 Pln | |
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 1000g | 2367.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A432321 |
4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline (CAS 13080-85-8) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline. InChIKey: HYDATEKARGDBKU-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline |
| InChIKey | HYDATEKARGDBKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)